CAS 13712-78-2
:7-Methylgramine
Description:
7-Methylgramine, identified by its CAS number 13712-78-2, is a chemical compound that belongs to the class of alkaloids. It is structurally related to gramine, which is a naturally occurring compound found in various plant species. The presence of a methyl group at the 7-position of the indole ring distinguishes it from its parent compound. This modification can influence its biological activity and properties. 7-Methylgramine is typically characterized by its nitrogen-containing heterocyclic structure, which contributes to its potential pharmacological effects. Alkaloids like 7-Methylgramine are often studied for their roles in plant defense mechanisms and their potential therapeutic applications, including antimicrobial and anti-inflammatory properties. However, detailed studies on its specific biological activities and toxicological profiles may be limited. As with many chemical substances, proper handling and safety precautions are essential due to potential health risks associated with exposure.
Formula:C12H16N2
InChI:InChI=1/C12H16N2/c1-9-5-4-6-11-10(8-14(2)3)7-13-12(9)11/h4-7,13H,8H2,1-3H3
SMILES:Cc1cccc2c(c[nH]c12)CN(C)C
Synonyms:- Indole, 3-((dimethylamino)methyl)-7-methyl-
- Brn 0128429
- N,N-dimethyl-1-(7-methyl-1H-indol-3-yl)methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Methylgramine
CAS:7-Methylgramine is a versatile building block that can be used in the synthesis of many complex compounds. It is a research chemical and speciality chemical with high quality and purity. 7-Methylgramine is also a useful intermediate for the synthesis of other compounds, as well as a reaction component for various organic reactions, such as Wittig reactions, acylation reactions, Friedel-Crafts reactions, and Michael additions. This compound has CAS number 13712-78-2.Formula:C12H16N2Molecular weight:188.27 g/mol7-Methylgramine
CAS:Please enquire for more information about 7-Methylgramine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C12H16N2Purity:Min. 95%Color and Shape:PowderMolecular weight:188.27 g/mol


