CymitQuimica logo

CAS 137130-31-5

:

1-{2,4,6-trihydroxy-3-[7-hydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]phenyl}dodecan-1-one

Description:
The chemical substance known as 1-{2,4,6-trihydroxy-3-[7-hydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]phenyl}dodecan-1-one, with the CAS number 137130-31-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple hydroxyl groups and a long aliphatic chain. This compound features a dodecanone moiety, indicating the presence of a ketone functional group within a twelve-carbon chain, contributing to its hydrophobic characteristics. The presence of multiple hydroxyl groups suggests potential for hydrogen bonding, which may enhance its solubility in polar solvents and influence its biological activity. The chromenyl structure indicates that it may exhibit properties typical of flavonoids, such as antioxidant activity. Additionally, the compound's phenolic components may contribute to its reactivity and potential applications in pharmaceuticals or as a natural product. Overall, this substance's unique structural features suggest a range of possible interactions and applications in various fields, including medicinal chemistry and materials science.
Formula:C33H40O7
InChI:InChI=1/C33H40O7/c1-2-3-4-5-6-7-8-9-10-11-26(36)32-28(38)20-27(37)31(33(32)39)25-19-29(21-12-14-22(34)15-13-21)40-30-18-23(35)16-17-24(25)30/h12-18,20,25,29,34-35,37-39H,2-11,19H2,1H3
Synonyms:
  • 1-Dodecanone, 1-(3-(3,4-dihydro-7-hydroxy-2-(4-hydroxyphenyl)-2H-1-benzopyran-4-yl)-2,4,6-trihydroxyphenyl)-
  • 1-(3-(3,4-Dihydro-7-hydroxy-2-(4-hydroxyphenyl)-2H-1-benzopyran-4-yl)-2,4,6-trihydroxyphenyl)-1-dodecanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.