CAS 137132-70-8
:8,11-dihydroxy-4-(2-hydroxyethyl)-6-((2-((2-hydroxyethyl)amino)ethyl)amino)-1,2,3,4,7,12-hexahydronaphtho(2,3-f)quinoxaline-7,12-dione
Description:
8,11-Dihydroxy-4-(2-hydroxyethyl)-6-((2-((2-hydroxyethyl)amino)ethyl)amino)-1,2,3,4,7,12-hexahydronaphtho(2,3-f)quinoxaline-7,12-dione, with CAS number 137132-70-8, is a complex organic compound characterized by its multi-functional groups, including hydroxyl (-OH) and amino (-NH2) groups, which contribute to its solubility and reactivity. This compound features a naphthoquinoxaline backbone, which is known for its potential biological activity, particularly in medicinal chemistry. The presence of hydroxyethyl substituents suggests enhanced hydrophilicity, potentially influencing its pharmacokinetic properties. The structural complexity indicates that it may interact with various biological targets, making it of interest in drug development. Its specific stereochemistry and functional groups may also play a crucial role in its biological activity, including potential antioxidant or anti-inflammatory effects. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, warranting further investigation for therapeutic applications.
Formula:C22H26N4O6
InChI:InChI=1/C22H26N4O6/c27-9-6-23-3-4-24-12-11-13-20(25-5-7-26(13)8-10-28)19-16(12)21(31)17-14(29)1-2-15(30)18(17)22(19)32/h1-2,11,23-25,27-30H,3-10H2
SMILES:c1cc(c2c(c1O)C(=O)c1c(cc3c(c1C2=O)NCCN3CCO)NCCNCCO)O
Synonyms:- Dhhnqd
- Naphtho(2,3-f)quinoxaline-7,12-dione, 8,11-dihydroxy-1,2,3,4-tetrahydro-4-(2-hydroxyethyl)-6-((2-((2-hydroxyethyl)amino)ethyl)amino)-
- 8,11-Dihydroxy-4-(2-Hydroxyethyl)-6-({2-[(2-Hydroxyethyl)Amino]Ethyl}Amino)-1,2,3,4-Tetrahydronaphtho[2,3-F]Quinoxaline-7,12-Dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Mitoxantrone (2-Hydroxyethyl)piperazine Impurity(Mitoxantrone Impurity D)
CAS:Controlled Product<p>Applications A metabolite of the anticancer agent Mitoxantrone (M373425)<br>References Feafanov, A. et al.: Anticcancer Res., 19, 5341 (1999); Ponousis, C. et al.: Biochem. Pharmacol., 48, 2223 (1994);<br></p>Formula:C22H26N4O6Color and Shape:NeatMolecular weight:442.46Mitoxantrone (2-hydroxyethyl)piperazine impurity
CAS:<p>Mitoxantrone is an anticancer drug that is used to treat various types of cancer. Mitoxantrone is a prodrug, which means it needs to be metabolized by the body to become active. The main metabolic pathway for mitoxantrone involves hydrolysis of the 2-hydroxyethyl piperazine impurity and formation of N-desmethylmitoxantrone, which is a metabolite that has been found to be more potent than the parent compound in inhibiting DNA synthesis. This impurity standard is used as a reference substance for quality control purposes during drug development. Mitoxantrone can also be synthesized with high purity and custom synthesis services are available upon request.</p>Formula:C22H26N4O6Purity:Min. 95%Color and Shape:Brown PowderMolecular weight:442.47 g/mol


