CAS 137156-41-3
:Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate
Description:
Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a hydroxyl group (-OH) and an ethyl ester functional group, contributing to its reactivity and solubility properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, making it useful in various chemical applications. The presence of the carboxylate group enhances its potential as a ligand in coordination chemistry and as an intermediate in organic synthesis. Additionally, the triazole moiety is known for its biological activity, which may include antifungal and antimicrobial properties. Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate is of interest in pharmaceutical research and agrochemical development due to its unique structural features and potential applications in drug design and crop protection.
Formula:C5H7N3O3
InChI:InChI=1/C5H7N3O3/c1-2-11-5(9)4-3-8(10)7-6-4/h3,10H,2H2,1H3
SMILES:CCOC(=O)c1cn(nn1)O
Synonyms:- 1-Hydroxy-1H-1,2,3-triazole-5-carboxylic acid ethyl ester
- HOCt
- 1-Hydroxy-1H-1,2,3-Triazole-4-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 1-Hydroxy-1H-1,2,3-triazole-4-carboxylate
CAS:Formula:C5H7N3O3Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:157.131H-1,2,3-Triazole-4-carboxylic acid, 1-hydroxy-, ethyl ester
CAS:Formula:C5H7N3O3Purity:98%Color and Shape:SolidMolecular weight:157.1274Ethyl 1-Hydroxy-1H-1,2,3-triazole-4-carboxylate
CAS:Ethyl 1-Hydroxy-1H-1,2,3-triazole-4-carboxylatePurity:98%Molecular weight:157.13g/molHOCt
CAS:HOCt is a triazole-based coupling reagent used in solid-phase peptide synthesis with Fmoc-protected amino acids. HOCt requires the presence of a carbodiimide reagent such as DIC and has a high coupling efficiency with suppression of racemisation.
Formula:C5H7N3O3Purity:Min. 95%Molecular weight:157.13 g/mol




