CAS 137156-41-3

Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate

Description:

Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a hydroxyl group (-OH) and an ethyl ester functional group, contributing to its reactivity and solubility properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, making it useful in various chemical applications. The presence of the carboxylate group enhances its potential as a ligand in coordination chemistry and as an intermediate in organic synthesis. Additionally, the triazole moiety is known for its biological activity, which may include antifungal and antimicrobial properties. Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate is of interest in pharmaceutical research and agrochemical development due to its unique structural features and potential applications in drug design and crop protection.

Formula: C₅H₇N₃O₃

InChI: InChI=1/C5H7N3O3/c1-2-11-5(9)4-3-8(10)7-6-4/h3,10H,2H2,1H3

SMILES: CCOC(=O)c1cn(nn1)O

Synonyms:

• 1-Hydroxy-1H-1,2,3-triazole-5-carboxylic acid ethyl ester
• HOCt
• 1-Hydroxy-1H-1,2,3-Triazole-4-carboxylate

Ethyl 1-Hydroxy-1H-1,2,3-triazole-4-carboxylate

CAS: 137156-41-3

Formula: C₅H₇N₃O₃

Purity: >98.0%(T)(HPLC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 157.13

Ref: 3B-E0901

1H-1,2,3-Triazole-4-carboxylic acid, 1-hydroxy-, ethyl ester

CAS: 137156-41-3

Formula: C₅H₇N₃O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 157.1274

Ref: IN-DA0012VR

Ethyl 1-Hydroxy-1H-1,2,3-triazole-4-carboxylate

CAS: 137156-41-3

Ethyl 1-Hydroxy-1H-1,2,3-triazole-4-carboxylate

Purity: 98%

Molecular weight: 157.13g/mol

Ref: 54-OR72369

HOCt

CAS: 137156-41-3

Formula: C₅H₇N₃O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 157.049

Ref: 10-F051100

HOCt

CAS: 137156-41-3

HOCt is a triazole-based coupling reagent used in solid-phase peptide synthesis with Fmoc-protected amino acids. HOCt requires the presence of a carbodiimide reagent such as DIC and has a high coupling efficiency with suppression of racemisation.

Formula: C₅H₇N₃O₃

Purity: Min. 95%

Molecular weight: 157.13 g/mol

Ref: 3D-FH15662