CAS 137180-64-4

4-(2-Chloroacetyl)-1-oxaspiro[4.5]decan-2-one

Description:

4-(2-Chloroacetyl)-1-oxaspiro[4.5]decan-2-one, identified by its CAS number 137180-64-4, is a chemical compound characterized by its spirocyclic structure, which features a unique arrangement of carbon atoms that creates a bicyclic framework. This compound contains a chloroacetyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the oxaspiro moiety indicates that it contains an ether linkage, which can influence its physical and chemical properties, such as solubility and stability. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. The specific functional groups present in this molecule suggest potential for further derivatization, which could enhance its pharmacological properties. Additionally, the compound's molecular structure may impart specific stereochemical characteristics, influencing its interactions with biological targets. Overall, 4-(2-Chloroacetyl)-1-oxaspiro[4.5]decan-2-one represents a versatile scaffold for further research and development in various chemical and pharmaceutical applications.

Formula: C₁₁H₁₅ClO₃

InChI: InChI=1S/C11H15ClO3/c12-7-9(13)8-6-10(14)15-11(8)4-2-1-3-5-11/h8H,1-7H2

InChI key: InChIKey=PKSKXRXSHMEHSH-UHFFFAOYSA-N

SMILES: C(CCl)(=O)C1C2(OC(=O)C1)CCCCC2

Synonyms:

• 1-Oxaspiro[4.5]decan-2-one, 4-(2-chloroacetyl)-
• 1-Oxaspiro[4.5]decan-2-one, 4-(chloroacetyl)-
• 4-(2-Chloroacetyl)-1-oxaspiro[4.5]decan-2-one

1-Oxaspiro[4.5]decan-2-one, 4-(2-chloroacetyl)-

CAS: 137180-64-4

Formula: C₁₁H₁₅ClO₃

Molecular weight: 230.688

Ref: IN-DA0012X5