CAS 137180-65-5
:4-(2-AMINO-THIAZOL-4-YL)-1-OXA-SPIRO[4.5]DECAN-2-ONE
Description:
4-(2-Amino-thiazol-4-yl)-1-oxa-spiro[4.5]decan-2-one is a chemical compound characterized by its unique spirocyclic structure, which features a thiazole ring and an oxaspiro framework. The presence of the amino group on the thiazole contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability under different pH conditions. Its spiro structure can influence its conformational flexibility, which is crucial for interactions with biological targets. The compound may also participate in hydrogen bonding due to the presence of the amino and carbonyl functional groups, potentially affecting its reactivity and interaction with other molecules. Overall, 4-(2-amino-thiazol-4-yl)-1-oxa-spiro[4.5]decan-2-one represents a class of compounds that could be explored for pharmaceutical applications, particularly in the development of new therapeutic agents.
Formula:C12H16N2O2S
InChI:InChI=1/C12H16N2O2S/c13-11-14-9(7-17-11)8-6-10(15)16-12(8)4-2-1-3-5-12/h7-8H,1-6H2,(H2,13,14)/t8-/m0/s1
Synonyms:- (4R)-4-(2-amino-1,3-thiazol-4-yl)-1-oxaspiro[4.5]decan-2-one
- (4S)-4-(2-amino-1,3-thiazol-4-yl)-1-oxaspiro[4.5]decan-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
