CAS 137181-56-7
:Systemin
Description:
Systemin is a peptide hormone involved in plant defense mechanisms, particularly in response to herbivore attacks. It is primarily found in tomato plants and plays a crucial role in signaling pathways that activate the production of defensive compounds, such as proteinase inhibitors, which deter herbivores. Systemin is characterized by its relatively small size, typically consisting of a sequence of amino acids that allows it to function effectively in signaling. The CAS number 137181-56-7 specifically identifies this peptide, facilitating its recognition in chemical databases. Systemin operates through a receptor-mediated mechanism, triggering a cascade of physiological responses that enhance the plant's resilience against pests. Its discovery has significant implications for agricultural practices, as understanding its function can lead to the development of crops with improved resistance to herbivory, potentially reducing the need for chemical pesticides. Overall, systemin exemplifies the intricate biochemical interactions that underpin plant defense strategies in response to environmental stressors.
Formula:C85H144N26O28S
InChI:InChI=1/C85H144N26O28S/c1-43(2)65(106-67(121)44(3)89)77(131)100-49(25-27-61(91)115)71(125)104-55(41-112)75(129)101-52(19-8-11-32-88)79(133)109-35-14-22-58(109)81(135)108-34-13-21-57(108)76(130)105-56(42-113)74(128)98-47(18-7-10-31-87)69(123)97-48(20-12-33-95-85(93)94)70(124)102-53(39-63(117)118)80(134)110-36-15-23-59(110)82(136)111-37-16-24-60(111)84(138)139-83(137)54(40-64(119)120)103-78(132)66(45(4)114)107-73(127)50(26-28-62(92)116)99-72(126)51(29-38-140-5)96-68(122)46(90)17-6-9-30-86/h43-60,65-66,112-114H,6-42,86-90H2,1-5H3,(H2,91,115)(H2,92,116)(H,96,122)(H,97,123)(H,98,128)(H,99,126)(H,100,131)(H,101,129)(H,102,124)(H,103,132)(H,104,125)(H,105,130)(H,106,121)(H,107,127)(H,117,118)(H,119,120)(H4,93,94,95)/t44-,45+,46-,47-,48-,49-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-,65-,66-/m0/s1
Synonyms:- H-Ala-Val-Gln-Ser-Lys-Pro-Pro-Ser-Lys-Arg-Asp-Pro-Pro-Lys-Met-Gln-Thr-Asp-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Systemin
CAS:Systemin is an 18-amino acid polypeptide with the sequence AVQSKPPSKRDPPKMQTD that is found in Solanaceae plants (such as tomato and potato).Formula:C85H144N26O28SPurity:98%Color and Shape:SolidMolecular weight:2010.28Systemin
CAS:Peptide Systemin is a Research Peptide with significant interest within the field academic and medical research. This peptide is available for purchase at Cymit Quimica in multiple sizes and with a specification of your choice.Formula:C85H144N26O28SMolecular weight:2,010.32 g/molSystemin
CAS:Custom research peptide; min purity 95%.Formula:C85H144N26O28SPurity:Min. 95%Molecular weight:2,010.32 g/mol

