CAS 13720-94-0
:4-Chloroquinoline-3-carboxylic acid ethyl ester
Description:
4-Chloroquinoline-3-carboxylic acid ethyl ester is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chloro group at the 4-position and an ethyl ester functional group at the 3-carboxylic acid position contributes to its chemical reactivity and potential applications. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in organic solvents. It is often used in medicinal chemistry and research due to its potential biological activities, including antimicrobial and anti-inflammatory properties. The compound's molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted, as it may pose hazards typical of halogenated compounds, including toxicity and environmental concerns. Proper handling and disposal procedures are essential when working with this substance in a laboratory setting.
Formula:C12H10ClNO2
InChI:InChI=1/C12H10ClNO2/c1-2-16-12(15)9-7-14-10-6-4-3-5-8(10)11(9)13/h3-7H,2H2,1H3
Synonyms:- Ethyl 4-Chloroquinoline-3-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Quinolinecarboxylic acid, 4-chloro-, ethyl ester
CAS:Formula:C12H10ClNO2Purity:97%Color and Shape:SolidMolecular weight:235.66634-Chloroquinoline-3-carboxylic acid ethyl ester
CAS:4-Chloroquinoline-3-carboxylic acid ethyl esterPurity:98%Molecular weight:235.6663g/molEthyl 4-Chloroquinoline-3-carboxylate
CAS:Formula:C12H10ClNO2Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:235.67Ethyl 4-chloroquinoline-3-carboxylate
CAS:Formula:C12H10ClNO2Purity:97%Color and Shape:SolidMolecular weight:235.67



