CAS 137206-73-6

5-Bromo-7-ethyl-2-formyl-benzofuran

Description:

5-Bromo-7-ethyl-2-formyl-benzofuran is an organic compound characterized by its unique structural features, which include a benzofuran core, a bromine substituent, and an aldehyde functional group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including electrophilic substitution reactions. The ethyl group enhances the hydrophobic character of the molecule, influencing its solubility and interaction with biological systems. The aldehyde group contributes to its reactivity, allowing for condensation reactions and potential applications in organic synthesis. This compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for practical applications and further research. Overall, 5-Bromo-7-ethyl-2-formyl-benzofuran represents a versatile scaffold in organic chemistry with potential implications in various fields.

Formula: C₁₁H₉BrO₂

InChI: InChI=1/C11H9BrO2/c1-2-7-3-9(12)4-8-5-10(6-13)14-11(7)8/h3-6H,2H2,1H3

SMILES: CCc1cc(cc2cc(C=O)oc12)Br

Synonyms:

• 5-Bromo-7-ethyl-2-benzofurancarboxaldehyde
• 5-Bromo-7-Ethyl-1-Benzofuran-2-Carbaldehyde

5-Bromo-7-ethyl-2-formyl-benzofuran

CAS: 137206-73-6

Formula: C₁₁H₉BrO₂

Color and Shape: Solid

Molecular weight: 253.0920

Ref: IN-DA0012XK

5-Bromo-7-ethyl-2-formyl-benzofuran

Controlled Product

CAS: 137206-73-6

Applications 5-Bromo-7-ethyl-2-formyl-benzofuran (cas# 137206-73-6) is a compound useful in organic synthesis.

Formula: C₁₁H₉BrO₂

Color and Shape: Neat

Molecular weight: 253.09

Ref: TR-B684245