CymitQuimica logo

CAS 13724-17-9

:

3-amino-6-(octyloxy)-L-phenylalanine

Description:
3-Amino-6-(octyloxy)-L-phenylalanine, with the CAS number 13724-17-9, is an amino acid derivative characterized by the presence of an amino group, a phenyl group, and an octyloxy side chain. This compound features a chiral center, which contributes to its potential biological activity and interactions. The octyloxy group enhances its lipophilicity, making it more soluble in organic solvents compared to standard amino acids. This property may influence its behavior in biological systems, potentially affecting membrane permeability and interactions with lipid environments. The presence of the amino group allows for participation in peptide bond formation, making it relevant in peptide synthesis and biochemistry. Additionally, the phenyl group can engage in π-π stacking interactions, which may be significant in protein folding and stability. Overall, 3-amino-6-(octyloxy)-L-phenylalanine is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential applications.
Formula:C17H28N2O3
InChI:InChI=1/C17H28N2O3/c1-2-3-4-5-6-7-10-22-16-9-8-14(18)11-13(16)12-15(19)17(20)21/h8-9,11,15H,2-7,10,12,18-19H2,1H3,(H,20,21)/t15-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.