CymitQuimica logo

CAS 13724-19-1

:

3-acetyl-4-(octyloxy)anilinium chloride

Description:
3-Acetyl-4-(octyloxy)anilinium chloride is an organic compound characterized by its anilinium structure, which includes an aniline derivative with an acetyl group and an octyloxy substituent. The presence of the octyloxy group contributes to its hydrophobic properties, making it soluble in organic solvents while potentially limiting its solubility in water. The acetyl group can influence the compound's reactivity and stability, often participating in various chemical reactions such as acylation or hydrolysis. As a quaternary ammonium salt, the chloride ion plays a crucial role in the compound's ionic characteristics, affecting its solubility and interaction with other substances. This compound may exhibit interesting properties such as surfactant behavior, making it useful in various applications, including pharmaceuticals, dyes, or as a surfactant in formulations. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases for precise information.
Formula:C16H26ClNO2
InChI:InChI=1/C16H25NO2.ClH/c1-3-4-5-6-7-8-11-19-16-10-9-14(17)12-15(16)13(2)18;/h9-10,12H,3-8,11,17H2,1-2H3;1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.