CAS 13726-19-7

4-Chloro-3-methoxybenzeneacetic acid

Description:

4-Chloro-3-methoxybenzeneacetic acid, with the CAS number 13726-19-7, is an organic compound characterized by its aromatic structure and functional groups. It features a chlorinated benzene ring, which contributes to its chemical reactivity and potential biological activity. The presence of a methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its interaction with biological systems. The acetic acid moiety provides acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. This compound may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in agrochemicals or pharmaceuticals, although specific uses would depend on further research into its biological effects and synthesis. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, 4-Chloro-3-methoxybenzeneacetic acid represents a versatile chemical entity with potential applications in various fields.

Formula: C₉H₉ClO₃

InChI: InChI=1S/C9H9ClO3/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4H,5H2,1H3,(H,11,12)

InChI key: InChIKey=HYHHKCKVSWCDHJ-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=CC(OC)=C(Cl)C=C1

Synonyms:

• 2-(4-Chloro-3-methoxyphenyl)acetic acid
• Acetic acid, (4-chloro-3-methoxyphenyl)-
• 4-Chloro-3-methoxybenzeneacetic acid
• Benzeneacetic acid, 4-chloro-3-methoxy-
• (4-Chloro-3-methoxyphenyl)acetic acid

2-(4-Chloro-3-methoxyphenyl)acetic acid

CAS: 13726-19-7

Formula: C₉H₉ClO₃

Molecular weight: 200.6190

Ref: IN-DA00130N

2-(4-Chloro-3-methoxyphenyl)acetic acid

CAS: 13726-19-7

Purity: 95+%

Molecular weight: 200.6199951

Ref: 10-F602134

2-(4-Chloro-3-methoxyphenyl)acetic acid

CAS: 13726-19-7

Versatile small molecule scaffold

Formula: C₉H₉ClO₃

Purity: Min. 95%

Molecular weight: 200.62 g/mol

Ref: 3D-NAA72619