CAS 13728-56-8
:4-(3-phenanthryl)butanoic acid
Description:
4-(3-Phenanthryl)butanoic acid, with the CAS number 13728-56-8, is an organic compound characterized by its structure, which features a butanoic acid moiety attached to a phenanthryl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential hydrophobicity due to the presence of the phenanthryl ring system. It is likely to be a solid at room temperature, given the size and complexity of its molecular structure. The presence of the carboxylic acid functional group (-COOH) suggests that it can participate in acid-base reactions and may exhibit acidic properties. Additionally, this compound may have applications in organic synthesis, materials science, or as a potential intermediate in the development of pharmaceuticals. Its solubility characteristics would depend on the solvent used, with potential solubility in organic solvents while being less soluble in water. Overall, 4-(3-phenanthryl)butanoic acid represents a unique structure that combines both aliphatic and aromatic features, contributing to its chemical behavior and potential applications.
Formula:C18H16O2
InChI:InChI=1/C18H16O2/c19-18(20)7-3-4-13-8-9-15-11-10-14-5-1-2-6-16(14)17(15)12-13/h1-2,5-6,8-12H,3-4,7H2,(H,19,20)
SMILES:c1ccc2c(c1)ccc1ccc(CCCC(=O)O)cc21
Synonyms:- 3-Phenanthrenebutanoic acid
- 4-(Phenanthren-3-Yl)Butanoic Acid
- 4-(3-Phenanthryl)butanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Phenanthrenebutanoic acid
CAS:Formula:C18H16O2Purity:99%Color and Shape:SolidMolecular weight:264.31844-(Phenanthren-3-Yl)Butanoic Acid
CAS:4-(Phenanthren-3-Yl)Butanoic AcidPurity:97%Molecular weight:264.32g/molHIV-1 Nef-IN-1
CAS:HIV-1 Nef-IN-1 is an inhibitor of HIV-1 Nef protein. It efficiently competes for Nef-SH3Hck interactions(Kd : 6.7 μM).Formula:C18H16O2Purity:99.90%Color and Shape:SolidMolecular weight:264.324-(PHENANTHREN-3-YL)BUTANOIC ACID
CAS:Purity:95%Color and Shape:SolidMolecular weight:264.3240051269533-Phenanthrenebutyric acid
CAS:3-Phenanthrenebutyric acid is a synthetic compound that serves as an analogue of phenanthrene derivatives, commonly utilized in biochemical and pharmacological research. Its source lies in laboratory synthesis, designed to mimic the structural properties of naturally occurring phenanthrene compounds, which are typically found in fossil fuels and plant sources.Formula:C18H16O2Purity:Min. 95%Molecular weight:264.3 g/mol




