CAS 137289-83-9
:N-{[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl}-2-(2-methoxyphenoxy)ethanamine dihydrochloride
Description:
N-{[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl}-2-(2-methoxyphenoxy)ethanamine dihydrochloride is a chemical compound characterized by its complex structure, which includes a piperidine ring, a benzothiazole moiety, and a methoxyphenoxy group. This compound is typically classified as a small organic molecule and may exhibit properties such as solubility in polar solvents due to the presence of amine and ether functional groups. The dihydrochloride form indicates that it is a salt, which can enhance its stability and solubility in aqueous solutions. Its potential applications may lie in medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of functional groups that can interact with biological targets. The compound's specific biological activity, pharmacokinetics, and toxicity profile would require further investigation through experimental studies. As with many chemical substances, proper handling and safety measures should be observed due to potential hazards associated with its use.
Formula:C22H29Cl2N3O2S
InChI:InChI=1/C22H27N3O2S.2ClH/c1-26-19-7-3-4-8-20(19)27-15-12-23-16-17-10-13-25(14-11-17)22-24-18-6-2-5-9-21(18)28-22;;/h2-9,17,23H,10-16H2,1H3;2*1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S 14063
CAS:S 14063 is a potent 5-HT1A receptor antagonist devoid of beta-adrenoceptor blocking properties.Formula:C22H29Cl2N3O2SColor and Shape:SolidMolecular weight:470.45
