CAS 137297-49-5: (Bromomethyl)-boronic acid bis(1-methylethyl) ester

Description:(Bromomethyl)-boronic acid bis(1-methylethyl) ester, with the CAS number 137297-49-5, is an organoboron compound characterized by the presence of a boronic acid functional group and a bromomethyl substituent. This compound typically exhibits a polar nature due to the boronic acid moiety, which can participate in hydrogen bonding and coordination with various nucleophiles. The presence of the isopropyl ester groups enhances its lipophilicity, making it more soluble in organic solvents. It is often utilized in organic synthesis, particularly in cross-coupling reactions, due to the reactivity of the boronic acid group. Additionally, the bromomethyl group can serve as a versatile electrophile, allowing for further functionalization. The compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, (Bromomethyl)-boronic acid bis(1-methylethyl) ester is a valuable intermediate in the synthesis of complex organic molecules, particularly in the fields of medicinal chemistry and materials science.

Formula:C₇H₁₆BBrO₂

InChI:InChI=1/C7H16BBrO2/c1-6(2)10-8(5-9)11-7(3)4/h6-7H,5H2,1-4H3

Synonyms:
Diisopropyl(bromomethyl)boronate
Bis(1-Methylethyl) (Bromomethyl)Boronate

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Boronic acid, B-(bromomethyl)-, bis(1-methylethyl) ester REF: IN-DA00132ICAS: 137297-49-5	95.0%	197.00 €~591.00 €	Thu 27 Mar 25
Diisopropyl (Bromomethyl)boronate REF: 3B-D3649CAS: 137297-49-5	>95.0%(GC)	120.00 €~405.00 €	Tue 01 Apr 25
(Bromomethyl)boronic acid, bis(isopropyl) ester REF: 54-OR7201CAS: 137297-49-5	95%	220.00 €~757.00 €	Thu 03 Apr 25
Diisopropyl(bromomethyl)boronate REF: 3D-FD160397CAS: 137297-49-5	Min. 95%	136.00 €~789.00 €	Thu 08 May 25