CAS 13730-55-7
:methyl 2,5-dimethylbenzoate
Description:
Methyl 2,5-dimethylbenzoate, with the CAS number 13730-55-7, is an aromatic ester characterized by its pleasant, fruity odor, making it useful in flavoring and fragrance applications. It is derived from benzoic acid and methanol, featuring a benzene ring substituted with two methyl groups at the 2 and 5 positions and a methoxy group at the carboxyl end. This compound is typically a colorless to pale yellow liquid at room temperature and is known for its moderate volatility. Methyl 2,5-dimethylbenzoate is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. It is stable under normal conditions but may undergo hydrolysis in the presence of strong acids or bases. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes. Overall, its unique structure and properties make it a valuable compound in various industrial applications.
Formula:C10H12O2
InChI:InChI=1/C10H12O2/c1-7-4-5-8(2)9(6-7)10(11)12-3/h4-6H,1-3H3
SMILES:Cc1ccc(C)c(c1)C(=O)OC
Synonyms:- Benzoic Acid, 2,5-Dimethyl-, Methyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,5-Dimethylbenzoic acid methyl ester
CAS:<p>2,5-Dimethylbenzoic acid methyl ester is an organic compound that belongs to the class of diketones. It is a crystalline solid with a melting point of about 120 °C. The compound is used for the synthesis of other chemicals and as a precursor to pharmaceuticals. 2,5-Dimethylbenzoic acid methyl ester can be produced by photocycloaddition, which involves uv irradiation and heat. This reaction produces two isomers: trans-2,5-dimethylbenzoic acid methyl ester and cis-2,5-dimethylbenzoic acid methyl ester. Trans-2,5-dimethylbenzoic acid methyl ester has been shown to undergo conformational change when heated to 120 °C, while cis-2,5-dimethylbenzoic acid methyl ester does not show this effect.</p>Formula:C10H12O2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:164.2 g/mol



