CAS 13731-82-3
:2,5-Dibromo-1,4-benzenedicarboxylic acid
Description:
2,5-Dibromo-1,4-benzenedicarboxylic acid is an aromatic compound characterized by the presence of two bromine atoms and two carboxylic acid groups attached to a benzene ring. Its molecular structure features a symmetrical arrangement, with the bromine substituents located at the 2 and 5 positions relative to the carboxylic acid groups at the 1 and 4 positions. This compound is typically a solid at room temperature and is known for its potential applications in organic synthesis and materials science, particularly in the development of polymers and as a precursor for various chemical reactions. The presence of bromine enhances its reactivity, making it useful in electrophilic substitution reactions. Additionally, the carboxylic acid groups contribute to its solubility in polar solvents and its ability to form hydrogen bonds, which can influence its physical properties and interactions with other substances. Safety precautions should be observed when handling this compound, as brominated compounds can pose environmental and health risks.
Formula:C8H4Br2O4
InChI:InChI=1/C8H4Br2O4/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h1-2H,(H,11,12)(H,13,14)
InChI key:InChIKey=VUTICWRXMKBOSF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C=C(C(O)=O)C(Br)=C1
Synonyms:- 1,4-Benzenedicarboxylic acid, 2,5-dibromo-
- 1,4-Dibromo-2,5-benzenedicarboxylic acid
- 2,5-Dibromo-1,4-benzenedicarboxylic acid
- 2,5-Dibromo-4-carboxybenzoic acid
- 2,5-Dibromobenzene-1,4-Dicarboxylic Acid
- 2,5-Dibromotetrephthalic acid
- NSC 115430
- Terephthalic acid, 2,5-dibromo-
- 2,5-Dibromoterephthalic acid
- 2,5-Dibromo-1,4-PhenyldicarboxylicAcid
- 2,5-dibromo-4-benzenedicarboxylicacid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,5-Dibromoterephthalic Acid
CAS:Formula:C8H4Br2O4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:323.921,4-Benzenedicarboxylic acid, 2,5-dibromo-
CAS:Formula:C8H4Br2O4Purity:97%Color and Shape:SolidMolecular weight:323.92302,5-Dibromoterephthalic acid
CAS:2,5-Dibromoterephthalic acidFormula:C8H4Br2O4Purity:≥95%Color and Shape: fine powderMolecular weight:323.92g/mol2,5-Dibromoterephthalic acid
CAS:2,5-Dibromoterephthalic acid is a compound that belongs to the group of dibromoterephthalic acid. The molecule has a supramolecular structure and contains water molecules. 2,5-Dibromoterephthalic acid can be oxidized to form the redox potential and is soluble in water. It has been shown that 2,5-Dibromoterephthalic acid can be absorbed by plants and animals through the skin or through the respiratory system. This compound has been used as an element analysis reagent for chlorine and carboxylates. 2,5-Dibromoterephthalic acid reacts with trifluoroacetic acid to form diethyl ester and hydrogen bond.Formula:C8H4Br2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:323.92 g/mol2,5-Dibromoterephthalic acid
CAS:Formula:C8H4Br2O4Purity:90%Color and Shape:SolidMolecular weight:323.924




