CymitQuimica logo

CAS 1373126-40-9

:

Ethyl 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6-methoxy-2-pyridinecarboxylate

Description:
Ethyl 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6-methoxy-2-pyridinecarboxylate is a chemical compound characterized by its unique structure, which includes a pyridine ring, a carboxylate group, and a dioxaborinane moiety. This compound is likely to exhibit properties typical of both its pyridine and boron-containing components, such as potential reactivity in nucleophilic substitution reactions and coordination chemistry. The presence of the methoxy group may enhance its solubility in organic solvents and influence its electronic properties. Additionally, the dioxaborinane structure can provide interesting applications in organic synthesis and materials science, particularly in the context of boron chemistry. The compound's molecular interactions, stability, and reactivity can be influenced by factors such as pH, temperature, and the presence of other functional groups. Overall, this compound may have potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C14H20BNO5
InChI:InChI=1S/C14H20BNO5/c1-5-19-13(17)11-7-6-10(12(16-11)18-4)15-20-8-14(2,3)9-21-15/h6-7H,5,8-9H2,1-4H3
InChI key:InChIKey=OZFQCZWJGLNWQY-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(C(OCC)=O)=N1)B2OCC(C)(C)CO2
Synonyms:
  • 2-Pyridinecarboxylic acid, 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6-methoxy-, ethyl ester
  • Ethyl 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6-methoxy-2-pyridinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.