CymitQuimica logo

CAS 1373205-41-4

:

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-(phosphonomethyl)glycine

Description:
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-(phosphonomethyl)glycine, commonly referred to as Fmoc-PMPG, is a chemical compound characterized by its unique structure that combines a fluorenylmethoxycarbonyl (Fmoc) protecting group with a phosphonomethyl group attached to glycine. This compound is primarily utilized in peptide synthesis and as a building block in the development of pharmaceuticals, particularly in the context of designing inhibitors for enzymes or receptors. The Fmoc group serves as a protective moiety that can be easily removed under mild basic conditions, facilitating the sequential addition of amino acids during peptide assembly. The phosphonomethyl group imparts additional properties, such as increased solubility and potential bioactivity, making it a valuable component in medicinal chemistry. The compound is typically solid at room temperature and may exhibit specific solubility characteristics in various organic solvents. Its stability and reactivity are influenced by the presence of the phosphonate moiety, which can participate in various chemical reactions, including those involving nucleophiles.
Formula:C18H18NO7P
InChI:InChI=1S/C18H18NO7P/c20-17(21)9-19(11-27(23,24)25)18(22)26-10-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2,(H,20,21)(H2,23,24,25)
InChI key:InChIKey=VJROATGKXPCGPH-UHFFFAOYSA-N
SMILES:C(OC(N(CP(=O)(O)O)CC(O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:
  • Glycine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-(phosphonomethyl)-
  • N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-(phosphonomethyl)glycine
  • GLYPHOSATE-FMOC
  • Fmoc-Glyphosate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.