CAS 1373205-41-4: N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-(phosphonomethyl)glycine

Description:N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-(phosphonomethyl)glycine, commonly referred to as Fmoc-PMPG, is a chemical compound characterized by its unique structure that combines a fluorenylmethoxycarbonyl (Fmoc) protecting group with a phosphonomethyl group attached to glycine. This compound is primarily utilized in peptide synthesis and as a building block in the development of pharmaceuticals, particularly in the context of designing inhibitors for enzymes or receptors. The Fmoc group serves as a protective moiety that can be easily removed under mild basic conditions, facilitating the sequential addition of amino acids during peptide assembly. The phosphonomethyl group imparts additional properties, such as increased solubility and potential bioactivity, making it a valuable component in medicinal chemistry. The compound is typically solid at room temperature and may exhibit specific solubility characteristics in various organic solvents. Its stability and reactivity are influenced by the presence of the phosphonate moiety, which can participate in various chemical reactions, including those involving nucleophiles.

Formula:C₁₈H₁₈NO₇P

InChI:InChI=1S/C18H18NO7P/c20-17(21)9-19(11-27(23,24)25)18(22)26-10-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2,(H,20,21)(H2,23,24,25)

InChI key:InChIKey=VJROATGKXPCGPH-UHFFFAOYSA-N

SMILES:O=C(O)CN(C(=O)OCC1C=2C=CC=CC2C=3C=CC=CC31)CP(=O)(O)O

Synonyms:
Glycine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-(phosphonomethyl)-
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-(phosphonomethyl)glycine

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Glyphosate-FMOC REF: 04-CA14051000CAS: 1373205-41-4	- - -	260.00 €	Tue 01 Apr 25
Glyphosate-FMOC 100 µg/mL in Acetonitrile:Water REF: 04-A14051000WL-100CAS: 1373205-41-4	- - -	To inquire	Tue 01 Apr 25
Glyphosphate-FMOC REF: 4Z-G-162009CAS: 1373205-41-4	- - -	To inquire	Thu 03 Apr 25
Glyphosphate-FMOC REF: TR-G765035CAS: 1373205-41-4	- - -	315.00 €~2,123.00 €	Tue 08 Apr 25
Glyphosphate-Fmoc REF: 3D-YEC20541CAS: 1373205-41-4	Min. 95%	- - -	Discontinued product