CymitQuimica logo

CAS 1373223-55-2

:

3-Bromo-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a]azepine

Description:
3-Bromo-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a]azepine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to an azepine ring. The presence of a bromine atom at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The compound's synthesis often involves multi-step organic reactions, and its properties can be influenced by the presence of substituents on the rings. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 3-Bromo-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a]azepine represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C8H11BrN2
InChI:InChI=1S/C8H11BrN2/c9-7-6-10-11-5-3-1-2-4-8(7)11/h6H,1-5H2
InChI key:InChIKey=OPRWCYVUVUXVOG-UHFFFAOYSA-N
SMILES:BrC1=C2N(N=C1)CCCCC2
Synonyms:
  • 4H-Pyrazolo[1,5-a]azepine, 3-bromo-5,6,7,8-tetrahydro-
  • 3-Bromo-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a]azepine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.