CAS 1373232-47-3

2-Bromobenzenesulfonyl fluoride

Description:

2-Bromobenzenesulfonyl fluoride is an organic compound characterized by the presence of a bromine atom and a sulfonyl fluoride functional group attached to a benzene ring. Its molecular structure features a sulfonyl group (–SO2) linked to a fluoride atom, which enhances its reactivity, particularly in nucleophilic substitution reactions. This compound is typically used as a reagent in organic synthesis, especially in the preparation of sulfonamides and other sulfonyl derivatives. It is known for its ability to act as an electrophile due to the electron-withdrawing nature of the sulfonyl fluoride group, making it useful in various chemical transformations. Additionally, 2-bromobenzenesulfonyl fluoride may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures in laboratory settings. Its physical properties, such as boiling point and solubility, can vary depending on the specific conditions and purity of the compound. Overall, this substance is valuable in synthetic organic chemistry for its reactivity and versatility.

Formula: C₆H₄BrFO₂S

InChI: InChI=1S/C6H4BrFO2S/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4H

InChI key: InChIKey=CVLBPNVZAWKPFN-UHFFFAOYSA-N

SMILES: S(F)(=O)(=O)C1=C(Br)C=CC=C1

Synonyms:

• Benzenesulfonyl fluoride, 2-bromo-
• 2-Bromobenzene-1-sulfonyl fluoride
• 2-Bromobenzenesulfonyl fluoride

2-Bromobenzenesulfonyl fluoride

CAS: 1373232-47-3

Formula: C₆H₄BrFO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 239.0622

Ref: IN-DA00HUVU

2-Bromobenzenesulfonyl fluoride

CAS: 1373232-47-3

2-Bromobenzenesulfonyl fluoride

Purity: 95%

Molecular weight: 239.06g/mol

Ref: 54-PC1003932

2-Bromobenzenesulfonyl fluoride

CAS: 1373232-47-3

Versatile small molecule scaffold

Formula: C₆H₄BrFO₂S

Purity: Min. 95%

Molecular weight: 239.06 g/mol

Ref: 3D-YEC23247