CymitQuimica logo

CAS 1373232-85-9

:

2-Amino-4-carboxybenzeneacetic acid

Description:
2-Amino-4-carboxybenzeneacetic acid, also known as 2-amino-4-(carboxymethyl)benzoic acid, is an organic compound characterized by its amino and carboxylic acid functional groups attached to a benzene ring. This compound features a carboxymethyl group, which contributes to its acidic properties. It is typically a white to off-white solid that is soluble in water due to the presence of polar functional groups. The presence of both amino and carboxylic acid groups allows it to participate in various chemical reactions, including acid-base reactions and potential coordination with metal ions. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its structural features suggest it could act as a ligand or a building block in the synthesis of more complex molecules. As with many amino acids and their derivatives, it may also play a role in metabolic pathways or serve as a precursor for the synthesis of other biologically relevant compounds.
Formula:C9H9NO4
InChI:InChI=1S/C9H9NO4/c10-7-3-6(9(13)14)2-1-5(7)4-8(11)12/h1-3H,4,10H2,(H,11,12)(H,13,14)
InChI key:InChIKey=AWEAADJNCLTMMV-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(N)C=C(C(O)=O)C=C1
Synonyms:
  • Benzeneacetic acid, 2-amino-4-carboxy-
  • 2-Amino-4-carboxybenzeneacetic acid
Found 5 products.