CAS 1373233-17-0

1,1-Dimethylethyl 3-[(phenylmethoxy)methyl]-1-azetidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(phenylmethoxy)methyl]-1-azetidinecarboxylate, identified by its CAS number 1373233-17-0, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and interactions. The presence of a phenylmethoxy group indicates that it has an aromatic component, which can enhance its lipophilicity and may affect its solubility in organic solvents. The carboxylate functional group suggests that it may participate in various chemical reactions, such as esterification or nucleophilic substitution. Overall, the structural features of this compound suggest potential applications in medicinal chemistry or as a synthetic intermediate, although specific biological activities or applications would require further investigation. Its unique combination of functional groups and ring structure may also impart interesting properties relevant to its use in various chemical contexts.

Formula: C₁₆H₂₃NO₃

InChI: InChI=1S/C16H23NO3/c1-16(2,3)20-15(18)17-9-14(10-17)12-19-11-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3

InChI key: InChIKey=ONUHNLXBKPXAAV-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(COCC2=CC=CC=C2)C1

Synonyms:

• 1-Azetidinecarboxylic acid, 3-[(phenylmethoxy)methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-[(phenylmethoxy)methyl]-1-azetidinecarboxylate

N-BOC-3-(Benzyloxymethyl)azetidine

CAS: 1373233-17-0

Formula: C₁₆H₂₃NO₃

Molecular weight: 277.3587

Ref: IN-DA00135H