CAS 1373253-21-4

1H-Pyrrolo[2,3-b]pyridin-4-amine, acetate (1:1)

Description:

1H-Pyrrolo[2,3-b]pyridin-4-amine, acetate (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as potential basicity due to the presence of nitrogen atoms. The acetate component suggests that the amine is protonated and forms a salt with acetic acid, which can influence its solubility and stability in various solvents. The compound may be of interest in medicinal chemistry due to its structural features, which could impart biological activity. Its CAS number, 1373253-21-4, allows for precise identification in chemical databases. As with many heterocyclic compounds, it may exhibit interesting electronic properties and reactivity, making it a candidate for further research in drug development or material science. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₇N₃·C₂H₄O₂

InChI: InChI=1S/C7H7N3.C2H4O2/c8-6-2-4-10-7-5(6)1-3-9-7;1-2(3)4/h1-4H,(H3,8,9,10);1H3,(H,3,4)

InChI key: InChIKey=DQXDMLNTPZMDBL-UHFFFAOYSA-N

SMILES: NC1=C2C(=NC=C1)NC=C2.C(C)(O)=O

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridin-4-amine, acetate (1:1)

1H-Pyrrolo[2,3-b]pyridin-4-amine, acetate (1:1)

CAS: 1373253-21-4

Formula: C₉H₁₁N₃O₂

Purity: 95%

Molecular weight: 193.2025

Ref: IN-DA001353

1H-pyrrolo[2,3-b]pyridin-4-amine; acetic acid

CAS: 1373253-21-4

Purity: 97%

Molecular weight: 193.2059937

Ref: 10-F752658