
CAS 1373253-27-0
:Azetidine, 3-(3-nitrophenoxy)-, hydrochloride (1:1)
Description:
Azetidine, 3-(3-nitrophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a 3-nitrophenoxy group indicates that a nitrophenyl moiety is attached to the azetidine at the third position, contributing to its chemical reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals. The nitro group on the phenoxy ring may impart specific electronic properties, influencing the compound's interactions in biological systems. This compound may be of interest in medicinal chemistry for its potential therapeutic effects, although specific biological activities would require further investigation. Safety data and handling precautions should be observed, as with any chemical substance, particularly those containing nitro groups, which can be sensitive and potentially hazardous.
Formula:C9H10N2O3·ClH
InChI:InChI=1S/C9H10N2O3.ClH/c12-11(13)7-2-1-3-8(4-7)14-9-5-10-6-9;/h1-4,9-10H,5-6H2;1H
InChI key:InChIKey=BFAQZXWPBYVTJJ-UHFFFAOYSA-N
SMILES:O(C1=CC(N(=O)=O)=CC=C1)C2CNC2.Cl
Synonyms:- Azetidine, 3-(3-nitrophenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
