CAS 137332-54-8

(5S)-8-chloro-5-methyl-6-(3-methylbut-2-en-1-yl)-4,5,6,7-tetrahydroimidazo[4,5,1-jk][1]benzazepine-2(1H)-thione

Description:

(5S)-8-chloro-5-methyl-6-(3-methylbut-2-en-1-yl)-4,5,6,7-tetrahydroimidazo[4,5,1-jk][1]benzazepine-2(1H)-thione is a complex organic compound characterized by its unique structural features, including a tetrahydroimidazo-benzazepine framework and a thione functional group. The presence of a chlorine atom and a methyl group contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit specific stereochemical properties due to its chiral center, which can influence its interactions in biological systems. The thione group may impart distinct chemical properties, such as potential coordination with metal ions or involvement in nucleophilic reactions. Given its intricate structure, this substance may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its CAS number, 137332-54-8, allows for easy identification and reference in chemical databases, facilitating research and application in various scientific fields.

Formula: C₁₇H₂₁ClN₂S

InChI: InChI=1/C17H21ClN2S/c1-10(2)4-5-12-8-13-14(18)6-7-15-16(13)20(9-11(12)3)17(21)19-15/h4,6-7,11-12H,5,8-9H2,1-3H3,(H,19,21)/t11-,12?/m1/s1

Synonyms:

• 137332-54-8
• Tivirapine
• 8-Chloro-TIBO
• Tivirapine [INN]

Tivirapine

CAS: 137332-54-8

Tivirapine, a reverse transcriptase inhibitor, is used potentially for the treatment of HIV infection.

Formula: C₁₆H₂₀ClN₃S

Color and Shape: Solid

Molecular weight: 321.87

Ref: TM-T28981