CAS 1373350-42-5
:1,1-Dimethylethyl 9-(phenylmethyl)-1,9-diazaspiro[5.5]undecane-1-carboxylate
Description:
1,1-Dimethylethyl 9-(phenylmethyl)-1,9-diazaspiro[5.5]undecane-1-carboxylate, with the CAS number 1373350-42-5, is a chemical compound characterized by its complex spirocyclic structure, which includes a diazaspiro framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the 1,1-dimethylethyl group suggests steric hindrance, which may influence its interactions with other molecules. The phenylmethyl substituent adds aromatic characteristics, potentially enhancing its stability and affecting its electronic properties. Such compounds may exhibit interesting biological activities, making them of interest in medicinal chemistry. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, as well as its reactivity and potential applications, would require further investigation through experimental studies or literature review. Overall, the unique structural features of this compound position it as a candidate for various chemical and pharmaceutical applications.
Formula:C21H32N2O2
InChI:InChI=1S/C21H32N2O2/c1-20(2,3)25-19(24)23-14-8-7-11-21(23)12-15-22(16-13-21)17-18-9-5-4-6-10-18/h4-6,9-10H,7-8,11-17H2,1-3H3
InChI key:InChIKey=SZNJCDSUYKNZSE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2(CCN(CC3=CC=CC=C3)CC2)CCCC1
Synonyms:- 1,1-Dimethylethyl 9-(phenylmethyl)-1,9-diazaspiro[5.5]undecane-1-carboxylate
- 1,9-Diazaspiro[5.5]undecane-1-carboxylic acid, 9-(phenylmethyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 9-benzyl-1,9-diazaspiro[5.5]undecane-1-carboxylate
CAS:tert-Butyl 9-benzyl-1,9-diazaspiro[5.5]undecane-1-carboxylate
Molecular weight:344.49g/mol
