CymitQuimica logo

CAS 1373350-61-8

:

5-(5-chloro-1-(3-fluorophenyl)-2-oxopentyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl acetate

Description:
5-(5-chloro-1-(3-fluorophenyl)-2-oxopentyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl acetate is a complex organic compound characterized by its unique structural features, including a thieno[3,2-c]pyridine core and various functional groups. The presence of a chloro substituent and a fluorophenyl group suggests potential biological activity, possibly influencing its pharmacological properties. The acetate moiety indicates that the compound may exhibit ester-like characteristics, which can affect its solubility and reactivity. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its intricate structure that may interact with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Additionally, the compound's stability, reactivity, and potential applications would be assessed through various analytical methods, including spectroscopy and chromatography. Overall, this compound represents a significant example of modern synthetic organic chemistry with potential implications in drug discovery and development.
Formula:C20H21ClFNO3S
InChI:InChI=1S/C20H21ClFNO3S/c1-13(24)26-19-11-15-12-23(9-7-18(15)27-19)20(17(25)6-3-8-21)14-4-2-5-16(22)10-14/h2,4-5,10-11,20H,3,6-9,12H2,1H3
SMILES:CC(=O)Oc1cc2CN(CCc2s1)C(c1cccc(c1)F)C(=O)CCCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.