CAS 1373393-48-6

B-(2-Chloro-4,6-difluorophenyl)boronic acid

Description:

B-(2-Chloro-4,6-difluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated and fluorinated aromatic ring. This compound typically exhibits a white to off-white crystalline solid form. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of chlorine and fluorine substituents on the phenyl ring can influence the compound's reactivity, solubility, and biological activity. Additionally, the fluorine atoms can enhance lipophilicity and metabolic stability, which are important factors in drug design. This compound is often utilized in the development of pharmaceuticals and agrochemicals due to its ability to form stable complexes with diols and other nucleophiles. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper safety protocols are followed.

Formula: C₆H₄BClF₂O₂

InChI: InChI=1S/C6H4BClF2O2/c8-4-1-3(9)2-5(10)6(4)7(11)12/h1-2,11-12H

InChI key: InChIKey=CVKSBWKPNRLZGR-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(Cl)C=C(F)C=C1F

Synonyms:

• (2-Chloro-4,6-difluorophenyl)boronic acid
• Boronic acid, B-(2-chloro-4,6-difluorophenyl)-
• B-(2-Chloro-4,6-difluorophenyl)boronic acid

2-Chloro-4,6-difluorobenzene boronic acid

CAS: 1373393-48-6

2-Chloro-4,6-difluorobenzene boronic acid

Purity: 95%

Color and Shape: Solid

Molecular weight: 192.36g/mol

Ref: 54-PC44901

(2-Chloro-4,6-difluorophenyl)boronic acid

CAS: 1373393-48-6

Purity: 95%

Molecular weight: 192.3500061

Ref: 10-F691469

(2-Chloro-4,6-difluorophenyl)boronic acid

CAS: 1373393-48-6

Versatile small molecule scaffold

Formula: C₆H₄BClF₂O₂

Purity: Min. 95%

Molecular weight: 192.36 g/mol

Ref: 3D-YEC39348