CAS 13735-04-1

3-[(4-bromophenyl)sulfanyl]propanoic acid

Description:

3-[(4-bromophenyl)sulfanyl]propanoic acid, with the CAS number 13735-04-1, is an organic compound characterized by the presence of a propanoic acid backbone substituted with a 4-bromophenyl group and a sulfanyl (thioether) functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobic characteristics due to the bromophenyl moiety. The presence of the carboxylic acid group (-COOH) imparts acidic properties, allowing it to participate in acid-base reactions. The bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. Additionally, the sulfanyl group can enhance the compound's nucleophilicity and may play a role in various chemical reactions, including substitution and addition reactions. Overall, this compound may find applications in organic synthesis, medicinal chemistry, and materials science, particularly in the development of pharmaceuticals or as intermediates in chemical reactions. Its specific physical and chemical properties, such as solubility and melting point, would require empirical measurement for precise characterization.

Formula: C₉H₉BrO₂S

InChI: InChI=1/C9H9BrO2S/c10-7-1-3-8(4-2-7)13-6-5-9(11)12/h1-4H,5-6H2,(H,11,12)

SMILES: c1cc(ccc1Br)SCCC(=O)O

Synonyms:

• 3-[(4-Bromophenyl)Thio]Propanoic Acid
• Propanoic Acid, 3-[(4-Bromophenyl)Thio]-

3-(4-Bromophenyl)sulfanylpropanoic acid

CAS: 13735-04-1

Formula: C₉H₉BrO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 261.1356

Ref: IN-DA009IL6

3-(4-Bromophenylthio)propionic acid

CAS: 13735-04-1

3-(4-Bromophenylthio)propionic acid

Purity: ≥95%

Molecular weight: 261.138g/mol

Ref: 54-OR1002616

3-[(4-bromophenyl)sulfanyl]propanoic acid

CAS: 13735-04-1

Formula: C₉H₉BrO₂S

Purity: 98.0%

Molecular weight: 261.13

Ref: 10-F354566