CAS 13735-81-4: α-(Trimethylsiloxy)styrene
Description:α-(Trimethylsiloxy)styrene, with the CAS number 13735-81-4, is an organosilicon compound characterized by the presence of a styrene moiety substituted with trimethylsiloxy groups. This compound typically exhibits properties associated with both organic and silicone materials, such as enhanced thermal stability, hydrophobicity, and flexibility. The trimethylsiloxy groups contribute to its low surface energy and resistance to moisture, making it useful in various applications, including coatings, adhesives, and sealants. Additionally, the styrene component provides the potential for polymerization, allowing for the formation of copolymers that can enhance mechanical properties and processability. The compound is generally colorless to pale yellow and may have a low viscosity, depending on its molecular weight and structure. Safety data sheets should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure safe usage in industrial or laboratory settings.
Formula:C11H16OSi
InChI:InChI=1S/C11H16OSi/c1-10(12-13(2,3)4)11-8-6-5-7-9-11/h5-9H,1H2,2-4H3
InChI key:InChIKey=AFFPCIMDERUIST-UHFFFAOYSA-N
SMILES:O(C(=C)C=1C=CC=CC1)[Si](C)(C)C
- Synonyms:
- 1-(Trimethylsiloxy)-1-phenylethene
- 1-(Trimethylsilyloxy)-1-phenylethene
- 1-(Trimethylsilyloxy)-1-phenylethylene
- 1-(Trimethylsilyloxy)styrene
- 1-Phenyl-1-(Trimethylsilyloxy)Ethylene
- 1-Phenyl-1-(trimethylsiloxy)ethene
- 1-Phenyl-1-(trimethylsiloxy)ethylene
- 1-Phenyl-1-(trimethylsilyloxy)ethene
- 1-Phenylethenyloxytrimethylsilane
- Acetophenone trimethylsilyl enol ether
- See more synonyms
- Benzene, [1-[(trimethylsilyl)oxy]ethenyl]-
- Silane, trimethyl[(1-phenylethenyl)oxy]-
- Silane, trimethyl[(1-phenylvinyl)oxy]-
- Trimethyl(1-phenylethenyloxy)silane
- Trimethyl(1-phenylvinyloxy)silane
- Trimethyl[(1-Phenylethenyl)Oxy]Silane
- Trimethyl[(1-phenylvinyl)oxy]silan
- Trimethyl[(1-phenylvinyl)oxy]silane
- [(1-Fenilvinil)Oxi]Trimetilsilano
- [1-(Trimethylsiloxy)vinyl]benzene
- [1-[(Trimethylsilyl)oxy]ethenyl]benzene
- alpha-(Trimethylsiloxy)styrene
- α-(Trimethylsiloxy)styrene
- α-(Trimethylsilyloxy)styrene
