CAS 13737-31-0

1-BIPHENYL-2-YL-N-METHYLMETHYLAMINE

Description:

1-Biphenyl-2-yl-N-methylmethanamine, identified by its CAS number 13737-31-0, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methyl group attached to a nitrogen atom, which is further connected to a methanamine group. The presence of the biphenyl moiety contributes to its potential applications in various chemical reactions and as a building block in organic synthesis. The compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. Additionally, due to its structural characteristics, it may possess unique electronic properties, making it of interest in fields such as materials science and pharmaceuticals. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.

Formula: C₁₄H₁₅N

InChI: InChI=1/C14H15N/c1-15-11-13-9-5-6-10-14(13)12-7-3-2-4-8-12/h2-10,15H,11H2,1H3

SMILES: CNCc1ccccc1c1ccccc1

Synonyms:

• Biphenyl-2-Ylmethyl-Methyl-Amine
• N-Methyl-2-biphenylmethylamine
• 1-(biphenyl-2-yl)-N-methylmethanamine

methyl[(2-phenylphenyl)methyl]amine

CAS: 13737-31-0

Formula: C₁₄H₁₅N

Purity: 97%

Color and Shape: Solid

Molecular weight: 197.2756

Ref: IN-DA00136W

1-([1,1′-Biphenyl]-2-yl)-N-methylmethanamine

CAS: 13737-31-0

Formula: C₁₄H₁₅N

Purity: 97%

Molecular weight: 197.281

Ref: 10-F338356

1-(2-Biphenylyl)-N-methylmethanamine

CAS: 13737-31-0

1-(2-Biphenylyl)-N-methylmethanamine is a monosaccharide that belongs to the group of neochamaejasmine. It has been shown to have insecticidal properties and can be used as a pesticide. 1-(2-Biphenylyl)-N-methylmethanamine has been shown to contain diterpenoids, which are found in plants and insects. This compound also contains diterpenes, which are derived from terpene alcohols and are found in plants such as neochamaejasmin. The ethanol extract of 1-(2-biphenyl) N-methylmethanamine was found to have antimicrobial activity against bacteria such as Pseudomonas aeruginosa, Staphylococcus aureus, and Escherichia coli.

Formula: C₁₄H₁₅N

Purity: Min. 95%

Molecular weight: 197.28 g/mol

Ref: 3D-NAA73731