CAS 137372-00-0
:Ac-Thr-Leu-Asn-Phe-OH
Description:
The chemical substance "Ac-Thr-Leu-Asn-Phe-OH," with the CAS number 137372-00-0, is a synthetic peptide that consists of a sequence of amino acids, specifically acetylated threonine (Ac-Thr), leucine (Leu), asparagine (Asn), and phenylalanine (Phe), ending with a hydroxyl group (OH). This peptide is characterized by its specific sequence, which influences its biological activity and interactions. The acetylation at the N-terminus can enhance stability and bioavailability, while the presence of aromatic and polar side chains contributes to its solubility and potential interactions with biological targets. Peptides like this one are often studied for their roles in various biochemical processes, including signaling pathways and enzyme activity. The unique combination of amino acids can also impart specific structural properties, making it of interest in fields such as drug design, biochemistry, and molecular biology. Understanding its characteristics can provide insights into its potential applications in therapeutic contexts or as a research tool.
Formula:C25H37N5O8
InChI:InChI=1/C25H37N5O8/c1-13(2)10-17(29-24(36)21(14(3)31)27-15(4)32)22(34)28-18(12-20(26)33)23(35)30-19(25(37)38)11-16-8-6-5-7-9-16/h5-9,13-14,17-19,21,31H,10-12H2,1-4H3,(H2,26,33)(H,27,32)(H,28,34)(H,29,36)(H,30,35)(H,37,38)/t14-,17+,18+,19+,21+/m1/s1
Synonyms:- Acetylthreonyl-leucyl-asparaginyl-phenylalanine
- Ac-Thr-leu-asn-phe-cooh
- N-(N2-(N-(N-Acetyl-L-threonyl)-L-leucyl)-L-asparaginyl)-L-phenylalanine
- L-Phenylalanine, N-(N2-(N-(N-acetyl-L-threonyl)-L-leucyl)-L-asparaginyl)-
- N-acetyl-L-threonyl-L-leucyl-L-asparaginyl-L-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Ac-Thr-Leu-Asn-Phe-OH
CAS:<p>Ac-Thr-Leu-Asn-Phe-OH is a tetrapeptide that is synthesized from the amino acid sequence of human immunodeficiency virus (HIV) protease. It has been shown to inhibit HIV protease and prevent the cleavage of polypeptides, thereby preventing viral replication. The peptide is synthesized by reacting aspartyl with L-leucine in the presence of N,N′-dicyclohexylcarbodiimide and pyridine. Ac-Thr-Leu-Asn-Phe-OH was found to be resistant to proteases and has a constant molecular weight.</p>Formula:C25H37N5O8Purity:Min. 95%Molecular weight:535.59 g/mol
