CAS 13738-15-3
:5-amino-N-[2-(diethylamino)ethyl]-2-(octyloxy)benzamide
Description:
5-amino-N-[2-(diethylamino)ethyl]-2-(octyloxy)benzamide, with the CAS number 13738-15-3, is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical or bioactive agent. The presence of an amino group suggests it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The diethylamino group contributes to its basicity and may influence its pharmacokinetic properties, such as permeability and distribution within biological systems. The octyloxy substituent provides hydrophobic characteristics, which can affect the compound's interaction with lipid membranes and its overall bioavailability. This compound may exhibit specific biological activities due to its structural features, making it of interest in medicinal chemistry. Its unique combination of hydrophilic and hydrophobic elements suggests potential applications in drug formulation, where balance between solubility and membrane permeability is crucial. As with any chemical substance, safety and handling considerations are essential, particularly in laboratory or industrial settings.
Formula:C21H37N3O2
InChI:InChI=1/C21H37N3O2/c1-4-7-8-9-10-11-16-26-20-13-12-18(22)17-19(20)21(25)23-14-15-24(5-2)6-3/h12-13,17H,4-11,14-16,22H2,1-3H3,(H,23,25)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzamide, 5-amino-N-(2-(diethylamino)ethyl)-2-(octyloxy)-
CAS:<p>Benzamide, 5-amino-N-(2-(diethylamino)ethyl)-2-(octyloxy)- is a bioactive chemical.</p>Formula:C21H37N3O2Color and Shape:SolidMolecular weight:363.54
