CymitQuimica logo

CAS 13738-16-4

:

5-amino-2-(octyloxy)-N-phenylbenzamide

Description:
5-Amino-2-(octyloxy)-N-phenylbenzamide, with the CAS number 13738-16-4, is an organic compound characterized by its amide functional group and the presence of both an amino group and an octyloxy substituent. This compound features a phenyl ring, which contributes to its aromatic properties, and the octyloxy chain enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The amino group can participate in hydrogen bonding, which may affect its reactivity and interactions in various chemical environments. The structural arrangement suggests that it may exhibit interesting properties such as potential biological activity, making it a candidate for research in medicinal chemistry or materials science. Its molecular structure indicates that it could be used in applications ranging from pharmaceuticals to organic electronics, depending on its specific interactions and stability under different conditions. Overall, the combination of functional groups in this compound suggests a versatile chemical behavior that warrants further investigation.
Formula:C21H28N2O2
InChI:InChI=1/C21H28N2O2/c1-2-3-4-5-6-10-15-25-20-14-13-17(22)16-19(20)21(24)23-18-11-8-7-9-12-18/h7-9,11-14,16H,2-6,10,15,22H2,1H3,(H,23,24)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.