CAS 13738-63-1
:1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene
Description:
1,5-Dichloro-3-fluoro-2-(4-nitrophenoxy)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms, one fluorine atom, and a nitrophenoxy group. The presence of chlorine and fluorine atoms contributes to its potential as a halogenated compound, which may exhibit unique reactivity and stability properties. The nitrophenoxy group introduces a strong electron-withdrawing effect, influencing the compound's electronic properties and reactivity. This compound is typically used in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific molecular interactions and the presence of functional groups. Additionally, due to the presence of halogens and a nitro group, it may exhibit environmental persistence and potential toxicity, necessitating careful handling and assessment in laboratory and industrial settings.
Formula:C12H6Cl2FNO3
InChI:InChI=1/C12H6Cl2FNO3/c13-7-5-10(14)12(11(15)6-7)19-9-3-1-8(2-4-9)16(17)18/h1-6H
InChI key:InChIKey=MVHWKYHDYCGNQN-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=C(Cl)C=C1F)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 2,4-Dichloro-6-fluoro-4′-nitrodiphenyl ether
- 2,4-Dichloro-6-fluorophenyl p-nitrophenyl ether
- 2,4-Dichloro-6-fluorophenyl-4'-nitrophenyl ether
- 2-Fluoro-4,6-dichloro-4′-nitrodiphenyl ether
- 2-Fluoro-4,6-dichlorophenyl 4-nitrophenyl ether
- 4-Nitro-2′,4′-dichloro-6′-fluorodiphenyl ether
- Benzene, 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)-
- Benzene, 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)- (9CI)
- Brn 2298034
- Cfnp
- Ether, 2,4-dichloro-6-fluorophenyl p-nitrophenyl
- Fluoronitrofen
- Fluoronitrofen [ISO]
- Mo-500
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Fluoronitrofen
CAS:Controlled ProductApplications Fluoronitrofen contains pesticidal utility.
References Zhang, Y., et.al.: PCT Int. Appl. WO 2019236274 A1, 63, (2019);Formula:C12H6Cl2FNO3Color and Shape:NeatMolecular weight:302.09

