CAS 137384-48-6

6-CHLORO-3-METHYL-IMIDAZO[1,2-B]PYRIDAZINE

Description:

6-Chloro-3-methyl-imidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position and a methyl group at the 3-position enhances its reactivity and solubility in various organic solvents. This compound is typically of interest in medicinal chemistry and pharmaceutical research due to its potential biological activities, including antimicrobial and anticancer properties. Its molecular structure allows for various interactions with biological targets, making it a candidate for drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine and methyl substituents. As with many heterocycles, the synthesis and characterization of 6-chloro-3-methyl-imidazo[1,2-b]pyridazine are crucial for understanding its potential applications in various fields, including agrochemicals and materials science. Safety and handling precautions should be observed due to the presence of halogenated compounds, which may pose environmental and health risks.

Formula: C₇H₆ClN₃

InChI: InChI=1/C7H6ClN3/c1-5-4-9-7-3-2-6(8)10-11(5)7/h2-4H,1H3

SMILES: Cc1cnc2ccc(Cl)nn12

Synonyms:

• Imidazo[1,2-b]pyridazine, 6-chloro-3-methyl-
• 6-Chloro-3-Methylimidazo[1,2-B]Pyridazine

Imidazo[1,2-b]pyridazine, 6-chloro-3-methyl-

CAS: 137384-48-6

Formula: C₇H₆ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 167.5956

Ref: IN-DA001380

6-Chloro-3-methylimidazo[1,2-b]pyridazine

CAS: 137384-48-6

6-Chloro-3-methylimidazo[1,2-b]pyridazine

Purity: 95%

Molecular weight: 167.60g/mol

Ref: 54-OR960690

6-Chloro-3-methylimidazo[1,2-b]pyridazine

CAS: 137384-48-6

Formula: C₇H₆ClN₃

Purity: 97%

Color and Shape: Solid, No data available.

Molecular weight: 167.6

Ref: 10-F067622