CAS 13739-48-5

2-Methyl-4-phenyl-1H-imidazole

Description:

2-Methyl-4-phenyl-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methyl group at the second position and a phenyl group at the fourth position of the imidazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its reactivity and interactions with other molecules. 2-Methyl-4-phenyl-1H-imidazole may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical compounds. Its CAS number, 13739-48-5, is a unique identifier that facilitates the identification and study of this substance in scientific literature and databases. As with many imidazole derivatives, it may exhibit properties such as antifungal or antibacterial activity, making it a subject of research in pharmacology.

Formula: C₁₀H₁₀N₂

InChI: InChI=1/C10H10N2/c1-8-11-7-10(12-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12)

SMILES: Cc1ncc(c2ccccc2)[nH]1

Synonyms:

• 1H-imidazole, 2-methyl-4-phenyl-
• 2-Methyl-4-phenyl-1H-imidazole

1H-Imidazole, 2-methyl-5-phenyl-

CAS: 13739-48-5

Formula: C₁₀H₁₀N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 158.1998

Ref: IN-DA00138A

2-Methyl-4-phenyl-1H-imidazole

CAS: 13739-48-5

2-Methyl-4-phenyl-1H-imidazole

Purity: 98%

Molecular weight: 158.20g/mol

Ref: 54-OR942345

2-Methyl-4-phenyl-1H-imidazole

CAS: 13739-48-5

Formula: C₁₀H₁₀N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 158.204

Ref: 10-F068682