CAS 137391-68-5
:3-(2-Bromo-1-oxopropyl)-spiro[2H-1,3-benzoxazine-2,1'-cyclohexan]-4(3H)-one
Description:
3-(2-Bromo-1-oxopropyl)-spiro[2H-1,3-benzoxazine-2,1'-cyclohexan]-4(3H)-one, with the CAS number 137391-68-5, is a synthetic organic compound characterized by its complex spirocyclic structure. This compound features a spiro linkage between a benzoxazine moiety and a cyclohexanone, which contributes to its unique chemical properties. The presence of a bromo substituent and a ketone functional group enhances its reactivity, making it potentially useful in various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound may exhibit interesting biological activities due to its structural features, which could be explored in medicinal chemistry. Additionally, its solubility and stability in different solvents can vary, influencing its application in synthesis and formulation. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the bromine atom, which can pose health risks. Overall, this compound represents a valuable entity for research in organic synthesis and potential pharmaceutical applications.
Formula:C16H18BrNO3
InChI:InChI=1/C16H18BrNO3/c1-11(17)14(19)18-15(20)12-7-3-4-8-13(12)21-16(18)9-5-2-6-10-16/h3-4,7-8,11H,2,5-6,9-10H2,1H3
SMILES:CC(C(=O)N1C(=O)c2ccccc2OC21CCCCC2)Br
Synonyms:- Bpsbc
- BR-Comp
- 3-(2-bromopropanoyl)spiro[1,3-benzoxazine-2,1'-cyclohexan]-4(3H)-one
- F-9
- Meropenem Intermediates
- Meropenem intermediates F�C9
- (3S,4R)-3-[(1R)-1-Hydroxyethyl]-4-[(1R)-1-methyl-3-diazo-3-(p-nitrobenzyloxycarbonyl)-2-oxopropyl]azetidin-2-one
- F-9(Intermediate Of Meropenem)
- (R)-4-Nitrobenzyl 2-diazo-4-((2R,3S)-3-((R)-1-hydroxyethyl)-4-oxoazetidin-2-yl)-3-oxopentanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Nitrobenzyl(R)-2-diazo-4-((2R,3S)-3-((R)-1-hydroxyethyl)-4-oxoazetidin-2-yl)-3-oxopentanoate-2-14C
CAS:Formula:C17H18N4O7Purity:95%Color and Shape:SolidMolecular weight:390.3474(3S,4R)-3-[(1R)-1-Hydroxyethyl]-4-[(1R)-1-methyl-3-diazo-3- (p-nitrobenzyloxycarbonyl)-2-oxopropyl]azetidin-2 -one
CAS:CAS No. 137391-68-5 is a fine chemical that is used as a building block in organic chemistry research and as a reagent, speciality chemical, or intermediate. This compound has been shown to be useful in the synthesis of complex compounds and can be employed as a versatile building block for the synthesis of pharmaceuticals and other chemicals. This compound has also been shown to be an excellent reaction component, making it an ideal scaffold for the construction of larger molecules.Formula:C17H18N4O7Purity:Min. 96 Area-%Color and Shape:White PowderMolecular weight:390.35 g/mol

