CAS 1374006-96-8

1-Methyl-N-[4-[[(2S)-2-[2-(4-morpholinyl)ethyl]-1-piperidinyl]sulfonyl]phenyl]-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide

Description:

1-Methyl-N-[4-[[(2S)-2-[2-(4-morpholinyl)ethyl]-1-piperidinyl]sulfonyl]phenyl]-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide, with CAS number 1374006-96-8, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as a pyrazole ring, a sulfonamide moiety, and a trifluoromethyl group. This compound is typically classified as a small molecule and may exhibit properties relevant to medicinal chemistry, particularly in the context of drug development. Its structure suggests potential interactions with biological targets, possibly influencing pathways related to neurological or inflammatory conditions. The presence of the morpholine and piperidine rings indicates potential for lipophilicity, which can affect its pharmacokinetic properties, such as absorption and distribution. Additionally, the trifluoromethyl group may enhance metabolic stability and bioactivity. Overall, this compound's unique characteristics make it a subject of interest in pharmaceutical research, particularly for its potential therapeutic applications.

Formula: C₂₃H₃₀F₃N₅O₄S

InChI: InChI=1S/C23H30F3N5O4S/c1-29-20(16-21(28-29)23(24,25)26)22(32)27-17-5-7-19(8-6-17)36(33,34)31-10-3-2-4-18(31)9-11-30-12-14-35-15-13-30/h5-8,16,18H,2-4,9-15H2,1H3,(H,27,32)/t18-/m0/s1

InChI key: InChIKey=JVZHTUQIMBYDSX-SFHVURJKSA-N

SMILES: S(=O)(=O)(N1[C@H](CCN2CCOCC2)CCCC1)C3=CC=C(NC(=O)C4=CC(C(F)(F)F)=NN4C)C=C3

ERDRP-0519

CAS: 1374006-96-8

ERDRP-0519

Purity: ≥98%

Molecular weight: 529.58g/mol

Ref: 54-BUP02726

ERDRP-0519

CAS: 1374006-96-8

ERDRP-0519 is a small-molecule antiviral agent specifically designed to inhibit the activity of morbilliviruses. Derived from extensive medicinal chemistry efforts, it targets the viral RNA polymerase complex, crucial for viral replication. By interfering with this complex, ERDRP-0519 effectively impedes the synthesis of viral RNA, thus disrupting the virus's ability to propagate within host cells.

Formula: C₂₃H₃₀F₃N₅O₄S

Purity: Min. 95%

Molecular weight: 529.6 g/mol

Ref: 3D-ZEC00696

ERDRP-0519

CAS: 1374006-96-8

ERDRP-0519 is an oral measles polymerase inhibitor, preventing disease in monkeys, with potent nanomolar efficacy against morbilliviruses.

Formula: C₂₃H₃₀F₃N₅O₄S

Purity: 98.64% - 98.71%

Color and Shape: Solid

Molecular weight: 529.58

Ref: TM-T24040