CAS 1374258-30-6: 7-Bromo-1-methoxyisoquinoline

Description: 7-Bromo-1-methoxyisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 7-position and a methoxy group at the 1-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent's polarity. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the isoquinoline core, which is known for various biological activities. Additionally, the bromine substituent can serve as a useful handle for further chemical modifications, while the methoxy group may influence the compound's electronic properties and steric hindrance. As with many halogenated compounds, 7-Bromo-1-methoxyisoquinoline may also exhibit interesting photophysical properties, making it a candidate for studies in materials science and organic electronics. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₁₀H₈BrNO

InChI: InChI=1S/C10H8BrNO/c1-13-10-9-6-8(11)3-2-7(9)4-5-12-10/h2-6H,1H3

InChI key: InChIKey=RNZQCNYQATWREI-UHFFFAOYSA-N

SMILES: BrC=1C=CC=2C=CN=C(OC)C2C1

Synonyms:

• 7-Bromo-1-methoxyisoquinoline
• Isoquinoline, 7-bromo-1-methoxy-

7-Bromo-1-methoxyisoquinoline

CAS: 1374258-30-6

• Molecular weight: 238.08g/mol

7-BROMO-1-METHOXYISOQUINOLINE

CAS: 1374258-30-6

• Purity: 95%
• Molecular weight: 238.08399963378906