CymitQuimica logo

CAS 1374258-43-1

:

5-Bromo-7-(trifluoromethyl)-1H-indazole

Description:
5-Bromo-7-(trifluoromethyl)-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and a trifluoromethyl group at the 7-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural features that can interact with biological targets. The trifluoromethyl group enhances lipophilicity and metabolic stability, making it an attractive moiety in drug design. Additionally, the compound may exhibit interesting electronic properties due to the halogen substituents, which can affect its behavior in various chemical reactions. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.
Formula:C8H4BrF3N2
InChI:InChI=1S/C8H4BrF3N2/c9-5-1-4-3-13-14-7(4)6(2-5)8(10,11)12/h1-3H,(H,13,14)
InChI key:YLMFTTBYMVQLMH-UHFFFAOYSA-N
SMILES:c1c2cn[nH]c2c(cc1Br)C(F)(F)F
Found 5 products.