CymitQuimica logo

CAS 1374258-45-3

:

7-(Trifluoromethyl)-1H-indazole-5-carboxylic acid

Description:
7-(Trifluoromethyl)-1H-indazole-5-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a trifluoromethyl group (-CF3) at the 7-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The carboxylic acid functional group at the 5-position contributes to its acidity and reactivity, allowing for various chemical transformations and interactions. This compound is of interest in medicinal chemistry and pharmaceutical research due to its potential applications in drug development, particularly in targeting specific biological pathways. Its unique structural features may also impart specific pharmacokinetic and pharmacodynamic properties. Additionally, the trifluoromethyl group is known to improve metabolic stability and bioavailability, making such compounds valuable in the design of therapeutic agents. Overall, 7-(Trifluoromethyl)-1H-indazole-5-carboxylic acid exemplifies the intersection of structure and function in organic chemistry.
Formula:C9H5F3N2O2
InChI:InChI=1S/C9H5F3N2O2/c10-9(11,12)6-2-4(8(15)16)1-5-3-13-14-7(5)6/h1-3H,(H,13,14)(H,15,16)
InChI key:InChIKey=RDTKFZONKRNVBL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(=CC(C(O)=O)=C1)C=NN2
Synonyms:
  • 1H-Indazole-5-carboxylic acid, 7-(trifluoromethyl)-
  • 7-(Trifluoromethyl)-1H-indazole-5-carboxylic acid
Found 3 products.