CymitQuimica logo

CAS 1374264-45-5

:

Ethyl 2-amino-4-oxazoleacetate

Description:
Ethyl 2-amino-4-oxazoleacetate is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the amino group indicates potential for hydrogen bonding and reactivity in various chemical reactions, making it a versatile intermediate in organic synthesis. Ethyl 2-amino-4-oxazoleacetate may exhibit biological activity, which could be of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals. Its molecular structure suggests it may participate in nucleophilic substitution reactions, and its oxazole moiety could provide unique properties in coordination chemistry. Additionally, the compound's stability, solubility in organic solvents, and potential for functionalization make it a valuable candidate for further study in medicinal chemistry and materials science. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C7H10N2O3
InChI:InChI=1S/C7H10N2O3/c1-2-11-6(10)3-5-4-12-7(8)9-5/h4H,2-3H2,1H3,(H2,8,9)
InChI key:InChIKey=QULHZUSSAHUHLX-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C=1N=C(N)OC1
Synonyms:
  • 4-Oxazoleacetic acid, 2-amino-, ethyl ester
  • Ethyl 2-amino-4-oxazoleacetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.