CAS 137438-23-4
:4-CHLORO-7-METHYL-5,6,7,8-TETRAHYDRO[1]BENZOTHIENO[2,3-D]PYRIMIDINE
Description:
4-Chloro-7-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both a benzothieno moiety and a pyrimidine ring. The presence of a chlorine atom at the 4-position and a methyl group at the 7-position contributes to its unique chemical properties and potential biological activity. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and pharmacology. The compound may also display various functional properties, such as fluorescence or reactivity with other chemical species, which can be explored in research settings. Safety and handling precautions should be observed, as with any chemical substance, particularly due to the presence of chlorine, which can pose health risks. Overall, 4-chloro-7-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine represents a significant area of study for its potential applications in drug development and other chemical research.
Formula:C11H11ClN2S
InChI:InChI=1/C11H11ClN2S/c1-6-2-3-7-8(4-6)15-11-9(7)10(12)13-5-14-11/h5-6H,2-4H2,1H3
SMILES:CC1CCc2c(C1)sc1c2c(Cl)ncn1
Synonyms:- Buttpark 59\40-37
- Aurora 20204
- [1]Benzothieno[2,3-D]Pyrimidine, 4-Chloro-5,6,7,8-Tetrahydro-7-Methyl-
- (7S)-4-chloro-7-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
- (7R)-4-chloro-7-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Chloro-7-methyl-5,6,7,8-tetrahydrobenzo[b]thieno[2,3-d]pyrimidine, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H11ClN2SPurity:96%Color and Shape:Cream, PowderMolecular weight:238.733-chloro-11-methyl-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2,4,6-tetraene
CAS:Formula:C11H11ClN2SPurity:96%Molecular weight:238.73644-Chloro-7-methyl-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine
CAS:Purity:96.0%Molecular weight:238.72999572753906


