CAS 1374408-07-7

Butanamide, 4-amino-N-4-pyridinyl-, hydrochloride (1:2)

Description:

Butanamide, 4-amino-N-4-pyridinyl-, hydrochloride (1:2) is a chemical compound characterized by its amide functional group and a pyridine ring, which contributes to its biological activity. The presence of the amino group enhances its potential as a pharmacological agent, possibly influencing its solubility and interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound's molecular structure suggests it may exhibit properties such as moderate polarity and the ability to form hydrogen bonds, which can affect its reactivity and interaction with other molecules. Additionally, the specific arrangement of atoms within the butanamide and pyridine moieties may impart unique characteristics, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₁₃N₃O·2ClH

InChI: InChI=1S/C9H13N3O.2ClH/c10-5-1-2-9(13)12-8-3-6-11-7-4-8;;/h3-4,6-7H,1-2,5,10H2,(H,11,12,13);2*1H

InChI key: InChIKey=UDBIZDAIJZCSPV-UHFFFAOYSA-N

SMILES: N(C(CCCN)=O)C=1C=CN=CC1.Cl

Synonyms:

• Butanamide, 4-amino-N-4-pyridinyl-, hydrochloride (1:2)

4-amino-N-(pyridin-4-yl)butanamide dihydrochloride

CAS: 1374408-07-7

Formula: C₉H₁₅Cl₂N₃O

Purity: 95.0%

Molecular weight: 252.14

Ref: 10-F496193