CymitQuimica logo

CAS 137442-15-0

:

N-methyl-L-norleucylglycyl-N-[(2S)-2-[(L-alpha-aspartyl-L-tyrosyl)amino]-3-(4-nitrophenyl)propanoyl]-N-{(2S)-3-carboxy-2-[(N-methyl-L-norleucyl)amino]propanoyl}-L-tryptophanamide

Description:
N-methyl-L-norleucylglycyl-N-[(2S)-2-[(L-alpha-aspartyl-L-tyrosyl)amino]-3-(4-nitrophenyl)propanoyl]-N-{(2S)-3-carboxy-2-[(N-methyl-L-norleucyl)amino]propanoyl}-L-tryptophanamide, with CAS number 137442-15-0, is a complex peptide compound characterized by its intricate structure comprising multiple amino acid residues and functional groups. This substance features a combination of non-polar and polar side chains, contributing to its potential solubility in various solvents and biological activity. The presence of nitrophenyl and carboxylic acid groups suggests that it may exhibit specific reactivity and interactions with biological targets, possibly influencing its pharmacological properties. Additionally, the N-methylation of certain amino acids may enhance its stability and bioavailability. Such compounds are often studied for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug design, where their unique structural characteristics can lead to novel biological activities. Understanding the properties and behavior of this compound requires further investigation through experimental studies and computational modeling.
Formula:C53H69N11O15
InChI:InChI=1/C53H69N11O15/c1-5-7-12-38(55-3)48(72)58-29-44(66)59-42(25-32-28-57-37-14-10-9-11-35(32)37)52(76)63(53(77)43(27-46(69)70)62-49(73)39(56-4)13-8-6-2)51(75)41(24-30-15-19-33(20-16-30)64(78)79)61-50(74)40(23-31-17-21-34(65)22-18-31)60-47(71)36(54)26-45(67)68/h9-11,14-22,28,36,38-43,55-57,65H,5-8,12-13,23-27,29,54H2,1-4H3,(H,58,72)(H,59,66)(H,60,71)(H,61,74)(H,62,73)(H,67,68)(H,69,70)/t36-,38-,39-,40-,41-,42-,43-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.