CAS 13745-86-3
:11-Chloro-dibenzo[b,f][1,4]thiazepine
Description:
11-Chloro-dibenzo[b,f][1,4]thiazepine is a heterocyclic compound characterized by a fused ring system that includes both thiazepine and dibenzothiazole structures. This compound features a chlorine atom at the 11-position of the thiazepine ring, which influences its chemical reactivity and potential biological activity. The thiazepine ring consists of a seven-membered ring containing both sulfur and nitrogen atoms, contributing to its unique properties. The presence of the dibenzothiazole moiety enhances its aromatic character and may affect its solubility and stability in various solvents. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of therapeutic agents. Its structural features may allow for interactions with biological targets, making it a candidate for further research in drug discovery. However, specific data regarding its toxicity, environmental impact, and detailed reactivity would require further investigation and analysis in the context of chemical safety and regulatory guidelines.
Formula:C13H8ClNS
InChI:InChI=1S/C13H8ClNS/c14-13-9-5-1-3-7-11(9)16-12-8-4-2-6-10(12)15-13/h1-8H
InChI key:InChIKey=ZFOZNNFYECYUQB-UHFFFAOYSA-N
SMILES:ClC=1C=2C(SC=3C(N1)=CC=CC3)=CC=CC2
Synonyms:- Dibenzo[B,F][1,4]Thiazepine, 11-Chloro-
- 11-Chlorodibenzo[B,F]-[1,4]Thiazepine
- 11-Cholro-Dibanzo(B,F)[1,4]Thiazepine
- 11-Piperazin-1-Yl-Dibenzo-B,F-1,4ThiazepinDihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dibenzo[b,f][1,4]thiazepine, 11-chloro-
CAS:Formula:C13H8ClNSPurity:95%Color and Shape:SolidMolecular weight:245.7273Quetiapine Impurity 16
CAS:Formula:C13H8ClNSColor and Shape:White To Off-White SolidMolecular weight:245.7211-Chlorodibenzo[b,f][1,4]thiazepine
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:245.72000122070312Dibenzo-11-chloro[b,f][1,4]thiazepine
CAS:Dibenzo-11-chloro[b,f][1,4]thiazepine is an inorganic base that has a chemical formula of PCl. It is used as a pharmaceutical dosage form and is available in both solid and liquid forms. The compound is found in human urine and can be identified by chromatographic techniques such as reversed-phase high-performance liquid chromatography (RP-HPLC) with oxalyl or ultraviolet detection. Reaction time for the compound ranges from 5 to 10 minutes at room temperature. Dibenzo-11-chloro[b,f][1,4]thiazepine can be used for the preparation of pharmaceutical preparations such as tablets, pills, capsules, and solutions. This compound has been shown to have pharmacokinetic properties in humans with an average half life of 8 hours.
Formula:C13H8ClNSPurity:Min. 92%Color and Shape:White PowderMolecular weight:245.73 g/mol




