CAS 1374509-59-7

1-Cyanospiro[2.4]heptane-1-carboxylic acid

Description:

1-Cyanospiro[2.4]heptane-1-carboxylic acid is a chemical compound characterized by its unique spirocyclic structure, which consists of a seven-membered ring fused to a five-membered ring. The presence of a cyano group (-C≡N) and a carboxylic acid group (-COOH) contributes to its reactivity and potential applications in organic synthesis. This compound is typically colorless to pale yellow and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. The spiro structure can influence the compound's stereochemistry and conformational flexibility, which may affect its biological activity and interactions with other molecules. Additionally, the cyano group can serve as a versatile functional handle for further chemical modifications. As with many compounds containing cyano and carboxylic acid groups, it may exhibit acidic properties and participate in various chemical reactions, including nucleophilic additions and esterifications. Overall, 1-Cyanospiro[2.4]heptane-1-carboxylic acid is of interest in the fields of medicinal chemistry and materials science for its potential utility in synthesizing novel compounds.

Formula: C₉H₁₁NO₂

InChI: InChI=1S/C9H11NO2/c10-6-9(7(11)12)5-8(9)3-1-2-4-8/h1-5H2,(H,11,12)

InChI key: InChIKey=QQMRXHDDFHMLCE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(C#N)C2(C1)CCCC2

Synonyms:

• Spiro[2.4]heptane-1-carboxylic acid, 1-cyano-
• 1-Cyanospiro[2.4]heptane-1-carboxylic acid

1-Cyanospiro[2.4]heptane-1-carboxylic acid

CAS: 1374509-59-7

Versatile small molecule scaffold

Formula: C₉H₁₁NO₂

Purity: Min. 95%

Molecular weight: 165.19 g/mol

Ref: 3D-ZEC50959